C9H18ClN — CID 138040352
3-azabicyclo[4.3.1]decane;hydrochloride (PubChem CID 138040352) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is 3-azabicyclo[4.3.1]decane;hydrochloride.
| Compound Name | 3-azabicyclo[4.3.1]decane;hydrochloride |
|---|---|
| PubChem CID | 138040352 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-azabicyclo[4.3.1]decane;hydrochloride |
| SMILES | C1CC2CCNCC(C1)C2.Cl |
| InChI | InChI=1S/C9H17N.ClH/c1-2-8-4-5-10-7-9(3-1)6-8;/h8-10H,1-7H2;1H |
| InChIKey | REJJDCCQWGFRFC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |