C6H11ClF2N2O2S — CID 138040366
4-(2,2-difluoroethyl)piperazine-1-sulfonyl chloride (PubChem CID 138040366) has the molecular formula C6H11ClF2N2O2S and a molecular weight of 248.68 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)piperazine-1-sulfonyl chloride.
| Compound Name | 4-(2,2-difluoroethyl)piperazine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 138040366 |
| Molecular Formula | C6H11ClF2N2O2S |
| Molecular Weight | 248.68 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 4-(2,2-difluoroethyl)piperazine-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)N1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C6H11ClF2N2O2S/c7-14(12,13)11-3-1-10(2-4-11)5-6(8)9/h6H,1-5H2 |
| InChIKey | AYEOYAZQYFBPEX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |