C7H14F3N3O2S — CID 168812873
4-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide (PubChem CID 168812873) has the molecular formula C7H14F3N3O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide.
| Compound Name | 4-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 168812873 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-(3,3,3-trifluoropropyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C7H14F3N3O2S/c8-7(9,10)1-2-12-3-5-13(6-4-12)16(11,14)15/h1-6H2,(H2,11,14,15) |
| InChIKey | XYMBRMWHPMLRGY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |