C6H11F3N2O3S — CID 68565231
4-(2,2,2-trifluoroethyl)piperazine-1-sulfonic acid (PubChem CID 68565231) has the molecular formula C6H11F3N2O3S and a molecular weight of 248.23 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)piperazine-1-sulfonic acid.
| Compound Name | 4-(2,2,2-trifluoroethyl)piperazine-1-sulfonic acid |
|---|---|
| PubChem CID | 68565231 |
| Molecular Formula | C6H11F3N2O3S |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)piperazine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C6H11F3N2O3S/c7-6(8,9)5-10-1-3-11(4-2-10)15(12,13)14/h1-5H2,(H,12,13,14) |
| InChIKey | UPBXZOSJMSMKSM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|