C20H25N3O2 — CID 138044549
N-[4-(oxetan-3-yloxy)phenyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine (PubChem CID 138044549) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[4-(oxetan-3-yloxy)phenyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine.
| Compound Name | N-[4-(oxetan-3-yloxy)phenyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 138044549 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[4-(oxetan-3-yloxy)phenyl]-1-(pyridin-2-ylmethyl)piperidin-4-amine |
| SMILES | c1ccc(CN2CCC(Nc3ccc(OC4COC4)cc3)CC2)nc1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-10-21-18(3-1)13-23-11-8-17(9-12-23)22-16-4-6-19(7-5-16)25-20-14-24-15-20/h1-7,10,17,20,22H,8-9,11-15H2 |
| InChIKey | ODTCOCYIFFDFOJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|