C19H21N5 — CID 167808422
N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1,8-naphthyridin-2-amine (PubChem CID 167808422) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1,8-naphthyridin-2-amine.
| Compound Name | N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 167808422 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1,8-naphthyridin-2-amine |
| SMILES | c1ccc(CN2CCC(Nc3ccc4cccnc4n3)CC2)nc1 |
| InChI | InChI=1S/C19H21N5/c1-2-10-20-17(5-1)14-24-12-8-16(9-13-24)22-18-7-6-15-4-3-11-21-19(15)23-18/h1-7,10-11,16H,8-9,12-14H2,(H,21,22,23) |
| InChIKey | HSOQAZXHLJWQBY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |