C9H18N2O4S — CID 138045268
N-(3-hydroxy-3-methylcyclobutyl)morpholine-4-sulfonamide (PubChem CID 138045268) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(3-hydroxy-3-methylcyclobutyl)morpholine-4-sulfonamide.
| Compound Name | N-(3-hydroxy-3-methylcyclobutyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 138045268 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-(3-hydroxy-3-methylcyclobutyl)morpholine-4-sulfonamide |
| SMILES | CC1(O)CC(NS(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C9H18N2O4S/c1-9(12)6-8(7-9)10-16(13,14)11-2-4-15-5-3-11/h8,10,12H,2-7H2,1H3 |
| InChIKey | SRDWWIAMYMDVDI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |