About 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine
4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine (PubChem CID 138047211) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine |
| PubChem CID | 138047211 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine |
| SMILES | Cc1ocnc1-c1csc(CN2CCOCC2)n1 |
| InChI | InChI=1S/C12H15N3O2S/c1-9-12(13-8-17-9)10-7-18-11(14-10)6-15-2-4-16-5-3-15/h7-8H,2-6H2,1H3 |
| InChIKey | SFGWEEKFRLOERL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine?
The IUPAC name of 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine (CID 138047211) is 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine is Cc1ocnc1-c1csc(CN2CCOCC2)n1.
What is the InChIKey of 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine?
The InChIKey is SFGWEEKFRLOERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-9-12(13-8-17-9)10-7-18-11(14-10)6-15-2-4-16-5-3-15/h7-8H,2-6H2,1H3.
What are the key properties of 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine?
4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine has a molecular weight of 265.34 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(5-methyl-1,3-oxazol-4-yl)-1,3-thiazol-2-yl]methyl]morpholine is sourced from PubChem (CID 138047211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).