C15H17N3O3S — CID 131963040
2-hydroxy-5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]benzamide (PubChem CID 131963040) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-hydroxy-5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-hydroxy-5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 131963040 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-hydroxy-5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]benzamide |
| SMILES | NC(=O)c1cc(-c2csc(CN3CCOCC3)n2)ccc1O |
| InChI | InChI=1S/C15H17N3O3S/c16-15(20)11-7-10(1-2-13(11)19)12-9-22-14(17-12)8-18-3-5-21-6-4-18/h1-2,7,9,19H,3-6,8H2,(H2,16,20) |
| InChIKey | SOOOFSNHHAWSKD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |