C15H17N3O3S — CID 41156154
2-hydroxy-5-[2-[[(2S)-oxolan-2-yl]methylamino]-1,3-thiazol-4-yl]benzamide (PubChem CID 41156154) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[[(2S)-oxolan-2-yl]methylamino]-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-hydroxy-5-[2-[[(2S)-oxolan-2-yl]methylamino]-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 41156154 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-hydroxy-5-[2-[[(2S)-oxolan-2-yl]methylamino]-1,3-thiazol-4-yl]benzamide |
| SMILES | NC(=O)c1cc(-c2csc(NC[C@@H]3CCCO3)n2)ccc1O |
| InChI | InChI=1S/C15H17N3O3S/c16-14(20)11-6-9(3-4-13(11)19)12-8-22-15(18-12)17-7-10-2-1-5-21-10/h3-4,6,8,10,19H,1-2,5,7H2,(H2,16,20)(H,17,18)/t10-/m0/s1 |
| InChIKey | GFWNZUOPDTWECL-JTQLQIEISA-N |
| XLogP | 2.21 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |