C18H24FNO2 — CID 138047394
1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-(2-fluorophenyl)propan-1-one (PubChem CID 138047394) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-(2-fluorophenyl)propan-1-one.
| Compound Name | 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-(2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 138047394 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-(2-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccccc1F)N1[C@H](CO)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H24FNO2/c19-16-7-3-1-5-13(16)9-10-18(22)20-15(12-21)11-14-6-2-4-8-17(14)20/h1,3,5,7,14-15,17,21H,2,4,6,8-12H2/t14-,15-,17-/m0/s1 |
| InChIKey | QWRFFMFWMDGFQD-ZOBUZTSGSA-N |
| XLogP | 2.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |