C12H14F3N3O2 — CID 138049520
2,2,2-trifluoroethyl 4-pyridazin-4-ylpiperidine-1-carboxylate (PubChem CID 138049520) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-pyridazin-4-ylpiperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-pyridazin-4-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 138049520 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-pyridazin-4-ylpiperidine-1-carboxylate |
| SMILES | O=C(OCC(F)(F)F)N1CCC(c2ccnnc2)CC1 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)8-20-11(19)18-5-2-9(3-6-18)10-1-4-16-17-7-10/h1,4,7,9H,2-3,5-6,8H2 |
| InChIKey | QSDLTPLPDCUZIT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |