C14H19N3 — CID 138050008
(8aS)-N-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 138050008) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is (8aS)-N-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | (8aS)-N-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 138050008 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (8aS)-N-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | c1ccc(CNC2=NC[C@@H]3CCCCN23)cc1 |
| InChI | InChI=1S/C14H19N3/c1-2-6-12(7-3-1)10-15-14-16-11-13-8-4-5-9-17(13)14/h1-3,6-7,13H,4-5,8-11H2,(H,15,16)/t13-/m0/s1 |
| InChIKey | IWWGNJBTKYQKMJ-ZDUSSCGKSA-N |
| XLogP | 2.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |