C21H24Cl2N2 — CID 11888526
(1R,4aS)-2-benzyl-1-(3,4-dichlorophenyl)-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine (PubChem CID 11888526) has the molecular formula C21H24Cl2N2 and a molecular weight of 375.34 g/mol. Its IUPAC name is (1R,4aS)-2-benzyl-1-(3,4-dichlorophenyl)-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine.
| Compound Name | (1R,4aS)-2-benzyl-1-(3,4-dichlorophenyl)-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 11888526 |
| Molecular Formula | C21H24Cl2N2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (1R,4aS)-2-benzyl-1-(3,4-dichlorophenyl)-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidine |
| SMILES | Clc1ccc([C@@H]2N(Cc3ccccc3)CC[C@@H]3CCCCN32)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N2/c22-19-10-9-17(14-20(19)23)21-24(15-16-6-2-1-3-7-16)13-11-18-8-4-5-12-25(18)21/h1-3,6-7,9-10,14,18,21H,4-5,8,11-13,15H2/t18-,21+/m0/s1 |
| InChIKey | NCTAKURMVKIVDE-GHTZIAJQSA-N |
| XLogP | 5.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |