C23H31N3 — CID 7176847
4-[(1S,4aR)-2-benzyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidin-1-yl]-N,N-dimethylaniline (PubChem CID 7176847) has the molecular formula C23H31N3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-[(1S,4aR)-2-benzyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidin-1-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(1S,4aR)-2-benzyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidin-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7176847 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 4-[(1S,4aR)-2-benzyl-1,3,4,4a,5,6,7,8-octahydropyrido[1,2-c]pyrimidin-1-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@H]2N(Cc3ccccc3)CC[C@H]3CCCCN32)cc1 |
| InChI | InChI=1S/C23H31N3/c1-24(2)21-13-11-20(12-14-21)23-25(18-19-8-4-3-5-9-19)17-15-22-10-6-7-16-26(22)23/h3-5,8-9,11-14,22-23H,6-7,10,15-18H2,1-2H3/t22-,23+/m1/s1 |
| InChIKey | NEVIELUTPGBCJW-PKTZIBPZSA-N |
| XLogP | 4.51 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|