C16H23NO2S — CID 138051001
2-(2,5-dimethylphenyl)-1-(2-ethenylsulfonylethyl)pyrrolidine (PubChem CID 138051001) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-(2-ethenylsulfonylethyl)pyrrolidine.
| Compound Name | 2-(2,5-dimethylphenyl)-1-(2-ethenylsulfonylethyl)pyrrolidine |
|---|---|
| PubChem CID | 138051001 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-(2-ethenylsulfonylethyl)pyrrolidine |
| SMILES | C=CS(=O)(=O)CCN1CCCC1c1cc(C)ccc1C |
| InChI | InChI=1S/C16H23NO2S/c1-4-20(18,19)11-10-17-9-5-6-16(17)15-12-13(2)7-8-14(15)3/h4,7-8,12,16H,1,5-6,9-11H2,2-3H3 |
| InChIKey | LRGHROANYMOKFU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |