C13H15F2N3O2S2 — CID 138052552
N-(5-cyclopentyl-1H-pyrazol-3-yl)-4-(difluoromethyl)thiophene-3-sulfonamide (PubChem CID 138052552) has the molecular formula C13H15F2N3O2S2 and a molecular weight of 347.41 g/mol. Its IUPAC name is N-(5-cyclopentyl-1H-pyrazol-3-yl)-4-(difluoromethyl)thiophene-3-sulfonamide.
| Compound Name | N-(5-cyclopentyl-1H-pyrazol-3-yl)-4-(difluoromethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 138052552 |
| Molecular Formula | C13H15F2N3O2S2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(5-cyclopentyl-1H-pyrazol-3-yl)-4-(difluoromethyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(C2CCCC2)[nH]n1)c1cscc1C(F)F |
| InChI | InChI=1S/C13H15F2N3O2S2/c14-13(15)9-6-21-7-11(9)22(19,20)18-12-5-10(16-17-12)8-3-1-2-4-8/h5-8,13H,1-4H2,(H2,16,17,18) |
| InChIKey | JHIUBNTUDRJCTN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |