C12H12F2N2O3S2 — CID 138021169
4-(difluoromethyl)-N-(6-ethoxy-2-pyridinyl)thiophene-3-sulfonamide (PubChem CID 138021169) has the molecular formula C12H12F2N2O3S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-(6-ethoxy-2-pyridinyl)thiophene-3-sulfonamide.
| Compound Name | 4-(difluoromethyl)-N-(6-ethoxy-2-pyridinyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 138021169 |
| Molecular Formula | C12H12F2N2O3S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-(difluoromethyl)-N-(6-ethoxy-2-pyridinyl)thiophene-3-sulfonamide |
| SMILES | CCOc1cccc(NS(=O)(=O)c2cscc2C(F)F)n1 |
| InChI | InChI=1S/C12H12F2N2O3S2/c1-2-19-11-5-3-4-10(15-11)16-21(17,18)9-7-20-6-8(9)12(13)14/h3-7,12H,2H2,1H3,(H,15,16) |
| InChIKey | BTNBYDPKVFNWKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |