C13H17N7O — CID 138054517
1-(2-methyltetrazol-5-yl)-3-[(1-pyridin-2-ylcyclobutyl)methyl]urea (PubChem CID 138054517) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is 1-(2-methyltetrazol-5-yl)-3-[(1-pyridin-2-ylcyclobutyl)methyl]urea.
| Compound Name | 1-(2-methyltetrazol-5-yl)-3-[(1-pyridin-2-ylcyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 138054517 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(2-methyltetrazol-5-yl)-3-[(1-pyridin-2-ylcyclobutyl)methyl]urea |
| SMILES | Cn1nnc(NC(=O)NCC2(c3ccccn3)CCC2)n1 |
| InChI | InChI=1S/C13H17N7O/c1-20-18-11(17-19-20)16-12(21)15-9-13(6-4-7-13)10-5-2-3-8-14-10/h2-3,5,8H,4,6-7,9H2,1H3,(H2,15,16,18,21) |
| InChIKey | FCVAMGZGWRAFKF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |