C17H16F3N3O2 — CID 166250068
2-oxo-N-[(1-pyridin-2-ylcyclobutyl)methyl]-5-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 166250068) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-oxo-N-[(1-pyridin-2-ylcyclobutyl)methyl]-5-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[(1-pyridin-2-ylcyclobutyl)methyl]-5-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166250068 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-oxo-N-[(1-pyridin-2-ylcyclobutyl)methyl]-5-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC1(c2ccccn2)CCC1)c1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C17H16F3N3O2/c18-17(19,20)11-8-12(14(24)22-9-11)15(25)23-10-16(5-3-6-16)13-4-1-2-7-21-13/h1-2,4,7-9H,3,5-6,10H2,(H,22,24)(H,23,25) |
| InChIKey | WDPLMFFEPVPVEU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |