C14H21ClN4O — CID 138056694
(3aS,6aR)-N-(4-chloro-1-propan-2-ylpyrazol-3-yl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-3a-carboxamide (PubChem CID 138056694) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is (3aS,6aR)-N-(4-chloro-1-propan-2-ylpyrazol-3-yl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aR)-N-(4-chloro-1-propan-2-ylpyrazol-3-yl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 138056694 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3aS,6aR)-N-(4-chloro-1-propan-2-ylpyrazol-3-yl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-3a-carboxamide |
| SMILES | CC(C)n1cc(Cl)c(NC(=O)[C@]23CCC[C@H]2NCC3)n1 |
| InChI | InChI=1S/C14H21ClN4O/c1-9(2)19-8-10(15)12(18-19)17-13(20)14-5-3-4-11(14)16-7-6-14/h8-9,11,16H,3-7H2,1-2H3,(H,17,18,20)/t11-,14+/m1/s1 |
| InChIKey | OTQBCZXNZQSYPJ-RISCZKNCSA-N |
| XLogP | 2.59 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |