C19H28N2O2 — CID 166278183
(3aR,7aS)-N-[1-(4-propan-2-ylphenyl)ethyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-3a-carboxamide (PubChem CID 166278183) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3aR,7aS)-N-[1-(4-propan-2-ylphenyl)ethyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-3a-carboxamide.
| Compound Name | (3aR,7aS)-N-[1-(4-propan-2-ylphenyl)ethyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 166278183 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (3aR,7aS)-N-[1-(4-propan-2-ylphenyl)ethyl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrole-3a-carboxamide |
| SMILES | CC(C)c1ccc(C(C)NC(=O)[C@]23CCN[C@H]2CCOC3)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-13(2)15-4-6-16(7-5-15)14(3)21-18(22)19-9-10-20-17(19)8-11-23-12-19/h4-7,13-14,17,20H,8-12H2,1-3H3,(H,21,22)/t14?,17-,19-/m0/s1 |
| InChIKey | YABLDWPJYOFXJM-WGAGKFISSA-N |
| XLogP | 2.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |