C16H22N6O3S — CID 138058282
1-[2-(2-phenyltriazol-4-yl)acetyl]-2-[(sulfamoylamino)methyl]piperidine (PubChem CID 138058282) has the molecular formula C16H22N6O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is 1-[2-(2-phenyltriazol-4-yl)acetyl]-2-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-[2-(2-phenyltriazol-4-yl)acetyl]-2-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 138058282 |
| Molecular Formula | C16H22N6O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[2-(2-phenyltriazol-4-yl)acetyl]-2-[(sulfamoylamino)methyl]piperidine |
| SMILES | NS(=O)(=O)NCC1CCCCN1C(=O)Cc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N6O3S/c17-26(24,25)19-12-15-8-4-5-9-21(15)16(23)10-13-11-18-22(20-13)14-6-2-1-3-7-14/h1-3,6-7,11,15,19H,4-5,8-10,12H2,(H2,17,24,25) |
| InChIKey | SUUUYHQKMBCSGP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |