C15H20N4O3S — CID 154785610
1-[2-[(sulfamoylamino)methyl]piperidine-1-carbonyl]indolizine (PubChem CID 154785610) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-[2-[(sulfamoylamino)methyl]piperidine-1-carbonyl]indolizine.
| Compound Name | 1-[2-[(sulfamoylamino)methyl]piperidine-1-carbonyl]indolizine |
|---|---|
| PubChem CID | 154785610 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[2-[(sulfamoylamino)methyl]piperidine-1-carbonyl]indolizine |
| SMILES | NS(=O)(=O)NCC1CCCCN1C(=O)c1ccn2ccccc12 |
| InChI | InChI=1S/C15H20N4O3S/c16-23(21,22)17-11-12-5-1-4-9-19(12)15(20)13-7-10-18-8-3-2-6-14(13)18/h2-3,6-8,10,12,17H,1,4-5,9,11H2,(H2,16,21,22) |
| InChIKey | GHNYMGNYBPFXSO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |