C8H5BrN2OS — CID 138059210
6-bromo-2-sulfanylidene-4aH-quinazolin-4-one (PubChem CID 138059210) has the molecular formula C8H5BrN2OS and a molecular weight of 257.11 g/mol. Its IUPAC name is 6-bromo-2-sulfanylidene-4aH-quinazolin-4-one.
| Compound Name | 6-bromo-2-sulfanylidene-4aH-quinazolin-4-one |
|---|---|
| PubChem CID | 138059210 |
| Molecular Formula | C8H5BrN2OS |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 255.93 |
| IUPAC Name | 6-bromo-2-sulfanylidene-4aH-quinazolin-4-one |
| SMILES | O=C1NC(=S)N=C2C=CC(Br)=CC12 |
| InChI | InChI=1S/C8H5BrN2OS/c9-4-1-2-6-5(3-4)7(12)11-8(13)10-6/h1-3,5H,(H,11,12,13) |
| InChIKey | RQEXVGUJPLGRDM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|