About 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one
6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 170903679) has the molecular formula C6H4BrN3O
and a molecular weight of 214.02 g/mol. Its IUPAC name is 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 170903679 |
| Molecular Formula | C6H4BrN3O |
| Molecular Weight | 214.02 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1NC=NC2=NC(Br)=CC12 |
| InChI | InChI=1S/C6H4BrN3O/c7-4-1-3-5(10-4)8-2-9-6(3)11/h1-3H,(H,8,9,10,11) |
| InChIKey | FBJJBNGZNRQLDC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.02 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one (CID 170903679) is 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one is O=C1NC=NC2=NC(Br)=CC12.
What is the InChIKey of 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is FBJJBNGZNRQLDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O/c7-4-1-3-5(10-4)8-2-9-6(3)11/h1-3H,(H,8,9,10,11).
What are the key properties of 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one?
6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 214.02 g/mol, XLogP of 0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,4a-dihydropyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 170903679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).