C6H6N4OS — CID 137263668
2-methylimino-6,7a-dihydro-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 137263668) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 2-methylimino-6,7a-dihydro-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 2-methylimino-6,7a-dihydro-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 137263668 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 2-methylimino-6,7a-dihydro-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | C/N=C1\N=C2N=CNC(=O)C2S1 |
| InChI | InChI=1S/C6H6N4OS/c1-7-6-10-4-3(12-6)5(11)9-2-8-4/h2-3H,1H3,(H,7,8,9,10,11) |
| InChIKey | GAFDIAMFZBGTHP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|