C4H5N3O2 — CID 98071290
(5R)-5-amino-1H-pyrimidine-4,6-dione (PubChem CID 98071290) has the molecular formula C4H5N3O2 and a molecular weight of 127.10 g/mol. Its IUPAC name is (5R)-5-amino-1H-pyrimidine-4,6-dione.
| Compound Name | (5R)-5-amino-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 98071290 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | (5R)-5-amino-1H-pyrimidine-4,6-dione |
| SMILES | N[C@H]1C(=O)N=CNC1=O |
| InChI | InChI=1S/C4H5N3O2/c5-2-3(8)6-1-7-4(2)9/h1-2H,5H2,(H,6,7,8,9) |
| InChIKey | NVAMGZHAYTZQBT-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|