About 4-aminopyrazolidine-3,5-dione
4-aminopyrazolidine-3,5-dione (PubChem CID 82647065) has the molecular formula C3H5N3O2
and a molecular weight of 115.09 g/mol. Its IUPAC name is 4-aminopyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-aminopyrazolidine-3,5-dione |
| PubChem CID | 82647065 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 4-aminopyrazolidine-3,5-dione |
| SMILES | NC1C(=O)NNC1=O |
| InChI | InChI=1S/C3H5N3O2/c4-1-2(7)5-6-3(1)8/h1H,4H2,(H,5,7)(H,6,8) |
| InChIKey | FSLILBFOBYYBFQ-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-aminopyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyrazolidine-3,5-dione?
The IUPAC name of 4-aminopyrazolidine-3,5-dione (CID 82647065) is 4-aminopyrazolidine-3,5-dione.
What is the SMILES notation for 4-aminopyrazolidine-3,5-dione?
The canonical SMILES for 4-aminopyrazolidine-3,5-dione is NC1C(=O)NNC1=O.
What is the InChIKey of 4-aminopyrazolidine-3,5-dione?
The InChIKey is FSLILBFOBYYBFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2/c4-1-2(7)5-6-3(1)8/h1H,4H2,(H,5,7)(H,6,8).
What are the key properties of 4-aminopyrazolidine-3,5-dione?
4-aminopyrazolidine-3,5-dione has a molecular weight of 115.09 g/mol, XLogP of -2.53, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyrazolidine-3,5-dione is sourced from PubChem (CID 82647065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).