C3H5N3O2 — CID 82647065
4-aminopyrazolidine-3,5-dione (PubChem CID 82647065) has the molecular formula C3H5N3O2 and a molecular weight of 115.09 g/mol. Its IUPAC name is 4-aminopyrazolidine-3,5-dione.
| Compound Name | 4-aminopyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 82647065 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 4-aminopyrazolidine-3,5-dione |
| SMILES | NC1C(=O)NNC1=O |
| InChI | InChI=1S/C3H5N3O2/c4-1-2(7)5-6-3(1)8/h1H,4H2,(H,5,7)(H,6,8) |
| InChIKey | FSLILBFOBYYBFQ-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|