C5H8BrN3O2 — CID 76844825
6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione (PubChem CID 76844825) has the molecular formula C5H8BrN3O2 and a molecular weight of 222.04 g/mol. Its IUPAC name is 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 76844825 |
| Molecular Formula | C5H8BrN3O2 |
| Molecular Weight | 222.04 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)NC(=O)C(Br)C1N |
| InChI | InChI=1S/C5H8BrN3O2/c1-9-3(7)2(6)4(10)8-5(9)11/h2-3H,7H2,1H3,(H,8,10,11) |
| InChIKey | RCSKDVAJIKZDSY-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.04 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|