About 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one
4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 137229679) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one.
Analyze 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one (CID 137229679) is 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one is O=C1NC=NC2=NCCCC12.
What is the InChIKey of 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is VCYBOLJTZYPLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c11-7-5-2-1-3-8-6(5)9-4-10-7/h4-5H,1-3H2,(H,8,9,10,11).
What are the key properties of 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one?
4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 151.17 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,5,6,7-tetrahydro-3H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 137229679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).