C7H10N2O2 — CID 163910411
3-hydroxy-1,3,3a,4,5,6-hexahydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 163910411) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-hydroxy-1,3,3a,4,5,6-hexahydropyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 3-hydroxy-1,3,3a,4,5,6-hexahydropyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 163910411 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-hydroxy-1,3,3a,4,5,6-hexahydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1NC2=NCCCC2C1O |
| InChI | InChI=1S/C7H10N2O2/c10-5-4-2-1-3-8-6(4)9-7(5)11/h4-5,10H,1-3H2,(H,8,9,11) |
| InChIKey | QROWOJYTVFSILL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |