C4H5BrN2O — CID 174901121
2-bromo-2,4-dihydro-1H-pyrazin-3-one (PubChem CID 174901121) has the molecular formula C4H5BrN2O and a molecular weight of 177.00 g/mol. Its IUPAC name is 2-bromo-2,4-dihydro-1H-pyrazin-3-one.
| Compound Name | 2-bromo-2,4-dihydro-1H-pyrazin-3-one |
|---|---|
| PubChem CID | 174901121 |
| Molecular Formula | C4H5BrN2O |
| Molecular Weight | 177.00 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | 2-bromo-2,4-dihydro-1H-pyrazin-3-one |
| SMILES | O=C1NC=CNC1Br |
| InChI | InChI=1S/C4H5BrN2O/c5-3-4(8)7-2-1-6-3/h1-3,6H,(H,7,8) |
| InChIKey | AUVAOTMRORICED-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.00 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|