C6H10Cl2N4O — CID 143725427
3,4a,5,8-tetrahydro-2H-pteridin-4-one;dihydrochloride (PubChem CID 143725427) has the molecular formula C6H10Cl2N4O and a molecular weight of 225.08 g/mol. Its IUPAC name is 3,4a,5,8-tetrahydro-2H-pteridin-4-one;dihydrochloride.
| Compound Name | 3,4a,5,8-tetrahydro-2H-pteridin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 143725427 |
| Molecular Formula | C6H10Cl2N4O |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 3,4a,5,8-tetrahydro-2H-pteridin-4-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1NCN=C2NC=CNC12 |
| InChI | InChI=1S/C6H8N4O.2ClH/c11-6-4-5(9-3-10-6)8-2-1-7-4;;/h1-2,4,7H,3H2,(H,8,9)(H,10,11);2*1H |
| InChIKey | NRHWHYDMPCXQFH-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |