C5H8N4O — CID 138059344
5-amino-4-imino-2-methyl-1H-pyrimidin-6-one (PubChem CID 138059344) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 5-amino-4-imino-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-imino-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 138059344 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 5-amino-4-imino-2-methyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C1\N=C(C)NC(=O)C1N |
| InChI | InChI=1S/C5H8N4O/c1-2-8-4(7)3(6)5(10)9-2/h3H,6H2,1H3,(H2,7,8,9,10) |
| InChIKey | WGOSCJZEFRXFGC-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|