C20H15BrF3N3O2S — CID 138111503
2-[2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]ethyl]isoindole-1,3-dione;hydrobromide (PubChem CID 138111503) has the molecular formula C20H15BrF3N3O2S and a molecular weight of 498.32 g/mol. Its IUPAC name is 2-[2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]ethyl]isoindole-1,3-dione;hydrobromide.
| Compound Name | 2-[2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]ethyl]isoindole-1,3-dione;hydrobromide |
|---|---|
| PubChem CID | 138111503 |
| Molecular Formula | C20H15BrF3N3O2S |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | 2-[2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]ethyl]isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1c2ccccc2C(=O)N1CCc1csc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H14F3N3O2S.BrH/c21-20(22,23)12-4-3-5-13(10-12)24-19-25-14(11-29-19)8-9-26-17(27)15-6-1-2-7-16(15)18(26)28;/h1-7,10-11H,8-9H2,(H,24,25);1H |
| InChIKey | KLJKAECZRBIVBL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|