C19H13Cl2F3N4O2S — CID 135708635
N-[(Z)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide (PubChem CID 135708635) has the molecular formula C19H13Cl2F3N4O2S and a molecular weight of 489.31 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(Z)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 135708635 |
| Molecular Formula | C19H13Cl2F3N4O2S |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(Nc2cccc(C(F)(F)F)c2)n1)N/N=C\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl2F3N4O2S/c20-14-4-10(5-15(21)17(14)30)8-25-28-16(29)7-13-9-31-18(27-13)26-12-3-1-2-11(6-12)19(22,23)24/h1-6,8-9,30H,7H2,(H,26,27)(H,28,29)/b25-8- |
| InChIKey | RMDXQXAHDIIXOY-JAHAZDFLSA-N |
| XLogP | 5.61 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|