C26H19ClF4N4O2S — CID 6180167
N-[(Z)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide (PubChem CID 6180167) has the molecular formula C26H19ClF4N4O2S and a molecular weight of 562.98 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(Z)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 6180167 |
| Molecular Formula | C26H19ClF4N4O2S |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | N-[(Z)-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(Nc2cccc(C(F)(F)F)c2)n1)N/N=C\c1ccc(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C26H19ClF4N4O2S/c27-22-10-16(7-8-23(22)37-14-17-3-1-5-19(28)9-17)13-32-35-24(36)12-21-15-38-25(34-21)33-20-6-2-4-18(11-20)26(29,30)31/h1-11,13,15H,12,14H2,(H,33,34)(H,35,36)/b32-13- |
| InChIKey | HIZSBILHFGFPKY-VKVKMMGJSA-N |
| XLogP | 6.97 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|