C21H18F3IN4O3S — CID 137062410
N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide (PubChem CID 137062410) has the molecular formula C21H18F3IN4O3S and a molecular weight of 590.37 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 137062410 |
| Molecular Formula | C21H18F3IN4O3S |
| Molecular Weight | 590.37 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2csc(Nc3cccc(C(F)(F)F)c3)n2)cc(I)c1O |
| InChI | InChI=1S/C21H18F3IN4O3S/c1-2-32-17-7-12(6-16(25)19(17)31)10-26-29-18(30)9-15-11-33-20(28-15)27-14-5-3-4-13(8-14)21(22,23)24/h3-8,10-11,31H,2,9H2,1H3,(H,27,28)(H,29,30)/b26-10- |
| InChIKey | GGAYYZYILULYEB-KALUYTGESA-N |
| XLogP | 5.31 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|