C21H19F3N4O2S — CID 996618
N-[(4-methoxy-3-methylphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide (PubChem CID 996618) has the molecular formula C21H19F3N4O2S and a molecular weight of 448.47 g/mol. Its IUPAC name is N-[(4-methoxy-3-methylphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(4-methoxy-3-methylphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 996618 |
| Molecular Formula | C21H19F3N4O2S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[(4-methoxy-3-methylphenyl)methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1ccc(C=NNC(=O)Cc2csc(Nc3cccc(C(F)(F)F)c3)n2)cc1C |
| InChI | InChI=1S/C21H19F3N4O2S/c1-13-8-14(6-7-18(13)30-2)11-25-28-19(29)10-17-12-31-20(27-17)26-16-5-3-4-15(9-16)21(22,23)24/h3-9,11-12H,10H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | XFBPQDQSZISDJW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|