C23H32Cl2N2O — CID 138111583
2-[2-(4-chlorophenyl)-2-adamantyl]-1-(4-methylpiperazin-1-yl)ethanone;hydrochloride (PubChem CID 138111583) has the molecular formula C23H32Cl2N2O and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-adamantyl]-1-(4-methylpiperazin-1-yl)ethanone;hydrochloride.
| Compound Name | 2-[2-(4-chlorophenyl)-2-adamantyl]-1-(4-methylpiperazin-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 138111583 |
| Molecular Formula | C23H32Cl2N2O |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-adamantyl]-1-(4-methylpiperazin-1-yl)ethanone;hydrochloride |
| SMILES | CN1CCN(C(=O)CC2(c3ccc(Cl)cc3)C3CC4CC(C3)CC2C4)CC1.Cl |
| InChI | InChI=1S/C23H31ClN2O.ClH/c1-25-6-8-26(9-7-25)22(27)15-23(18-2-4-21(24)5-3-18)19-11-16-10-17(13-19)14-20(23)12-16;/h2-5,16-17,19-20H,6-15H2,1H3;1H |
| InChIKey | OFDUXLKHOBQIKG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |