C22H26FNO3 — CID 24945562
methyl 1-[2-[2-(4-fluorophenyl)-2-adamantyl]acetyl]aziridine-2-carboxylate (PubChem CID 24945562) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is methyl 1-[2-[2-(4-fluorophenyl)-2-adamantyl]acetyl]aziridine-2-carboxylate.
| Compound Name | methyl 1-[2-[2-(4-fluorophenyl)-2-adamantyl]acetyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 24945562 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | methyl 1-[2-[2-(4-fluorophenyl)-2-adamantyl]acetyl]aziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1C(=O)CC1(c2ccc(F)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H26FNO3/c1-27-21(26)19-12-24(19)20(25)11-22(15-2-4-18(23)5-3-15)16-7-13-6-14(9-16)10-17(22)8-13/h2-5,13-14,16-17,19H,6-12H2,1H3 |
| InChIKey | HZCWCJZSNSPWLH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|