C20H23FO3 — CID 59337200
2-[6-acetyl-2-(4-fluorophenyl)-2-adamantyl]acetic acid (PubChem CID 59337200) has the molecular formula C20H23FO3 and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-[6-acetyl-2-(4-fluorophenyl)-2-adamantyl]acetic acid.
| Compound Name | 2-[6-acetyl-2-(4-fluorophenyl)-2-adamantyl]acetic acid |
|---|---|
| PubChem CID | 59337200 |
| Molecular Formula | C20H23FO3 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[6-acetyl-2-(4-fluorophenyl)-2-adamantyl]acetic acid |
| SMILES | CC(=O)C1C2CC3CC1CC(C2)C3(CC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FO3/c1-11(22)19-12-6-15-8-13(19)9-16(7-12)20(15,10-18(23)24)14-2-4-17(21)5-3-14/h2-5,12-13,15-16,19H,6-10H2,1H3,(H,23,24) |
| InChIKey | WIDAFSACMIZXCO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |