C18H20BrFO2 — CID 24945322
2-[5-bromo-2-(4-fluorophenyl)-2-adamantyl]acetic acid (PubChem CID 24945322) has the molecular formula C18H20BrFO2 and a molecular weight of 367.26 g/mol. Its IUPAC name is 2-[5-bromo-2-(4-fluorophenyl)-2-adamantyl]acetic acid.
| Compound Name | 2-[5-bromo-2-(4-fluorophenyl)-2-adamantyl]acetic acid |
|---|---|
| PubChem CID | 24945322 |
| Molecular Formula | C18H20BrFO2 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[5-bromo-2-(4-fluorophenyl)-2-adamantyl]acetic acid |
| SMILES | O=C(O)CC1(c2ccc(F)cc2)C2CC3CC1CC(Br)(C3)C2 |
| InChI | InChI=1S/C18H20BrFO2/c19-17-7-11-5-13(8-17)18(10-16(21)22,14(6-11)9-17)12-1-3-15(20)4-2-12/h1-4,11,13-14H,5-10H2,(H,21,22) |
| InChIKey | IAXRDZPKGLAONF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|