C19H23FO3 — CID 59337004
2-[(2R,4S)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-2-adamantyl]acetic acid (PubChem CID 59337004) has the molecular formula C19H23FO3 and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-[(2R,4S)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-2-adamantyl]acetic acid.
| Compound Name | 2-[(2R,4S)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-2-adamantyl]acetic acid |
|---|---|
| PubChem CID | 59337004 |
| Molecular Formula | C19H23FO3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[(2R,4S)-2-(4-fluorophenyl)-4-hydroxy-4-methyl-2-adamantyl]acetic acid |
| SMILES | C[C@]1(O)C2CC3CC(C2)[C@@](CC(=O)O)(c2ccc(F)cc2)C1C3 |
| InChI | InChI=1S/C19H23FO3/c1-18(23)13-6-11-7-14(9-13)19(10-17(21)22,16(18)8-11)12-2-4-15(20)5-3-12/h2-5,11,13-14,16,23H,6-10H2,1H3,(H,21,22)/t11?,13?,14?,16?,18-,19+/m0/s1 |
| InChIKey | TXNHIVWODGVELE-ZNCXHKTGSA-N |
| XLogP | 3.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |