C23H32FN5O2 — CID 118370587
N'-[amino(methyl)amino]-1-[2-[2-(4-fluorophenyl)-6-hydroxy-2-adamantyl]acetyl]azetidine-3-carboximidamide (PubChem CID 118370587) has the molecular formula C23H32FN5O2 and a molecular weight of 429.54 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-1-[2-[2-(4-fluorophenyl)-6-hydroxy-2-adamantyl]acetyl]azetidine-3-carboximidamide.
| Compound Name | N'-[amino(methyl)amino]-1-[2-[2-(4-fluorophenyl)-6-hydroxy-2-adamantyl]acetyl]azetidine-3-carboximidamide |
|---|---|
| PubChem CID | 118370587 |
| Molecular Formula | C23H32FN5O2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N'-[amino(methyl)amino]-1-[2-[2-(4-fluorophenyl)-6-hydroxy-2-adamantyl]acetyl]azetidine-3-carboximidamide |
| SMILES | CN(N)/N=C(\N)C1CN(C(=O)CC2(c3ccc(F)cc3)C3CC4CC2CC(C3)C4O)C1 |
| InChI | InChI=1S/C23H32FN5O2/c1-28(26)27-22(25)15-11-29(12-15)20(30)10-23(16-2-4-19(24)5-3-16)17-6-13-7-18(23)9-14(8-17)21(13)31/h2-5,13-15,17-18,21,31H,6-12,26H2,1H3,(H2,25,27) |
| InChIKey | HXVSAHYFNKLICT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|