C28H32FNO3 — CID 59337332
2-[2-(4-fluorophenyl)-5-methoxy-2-adamantyl]-1-(3-phenoxyazetidin-1-yl)ethanone (PubChem CID 59337332) has the molecular formula C28H32FNO3 and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-5-methoxy-2-adamantyl]-1-(3-phenoxyazetidin-1-yl)ethanone.
| Compound Name | 2-[2-(4-fluorophenyl)-5-methoxy-2-adamantyl]-1-(3-phenoxyazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 59337332 |
| Molecular Formula | C28H32FNO3 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-5-methoxy-2-adamantyl]-1-(3-phenoxyazetidin-1-yl)ethanone |
| SMILES | COC12CC3CC(C1)C(CC(=O)N1CC(Oc4ccccc4)C1)(c1ccc(F)cc1)C(C3)C2 |
| InChI | InChI=1S/C28H32FNO3/c1-32-27-13-19-11-21(14-27)28(22(12-19)15-27,20-7-9-23(29)10-8-20)16-26(31)30-17-25(18-30)33-24-5-3-2-4-6-24/h2-10,19,21-22,25H,11-18H2,1H3 |
| InChIKey | HGRUNERBEXAGAD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |