C19H24ClNS — CID 87778774
2-[2-(4-chlorophenyl)-2-adamantyl]-N-methylethanethioamide (PubChem CID 87778774) has the molecular formula C19H24ClNS and a molecular weight of 333.93 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-adamantyl]-N-methylethanethioamide.
| Compound Name | 2-[2-(4-chlorophenyl)-2-adamantyl]-N-methylethanethioamide |
|---|---|
| PubChem CID | 87778774 |
| Molecular Formula | C19H24ClNS |
| Molecular Weight | 333.93 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-adamantyl]-N-methylethanethioamide |
| SMILES | CNC(=S)CC1(c2ccc(Cl)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H24ClNS/c1-21-18(22)11-19(14-2-4-17(20)5-3-14)15-7-12-6-13(9-15)10-16(19)8-12/h2-5,12-13,15-16H,6-11H2,1H3,(H,21,22) |
| InChIKey | DWFIRWJFASQVJP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|