C19H20Cl3NO3 — CID 1381151
[(2R)-3,4,4-trichlorobut-3-en-2-yl] (1S,6S)-6-(benzylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 1381151) has the molecular formula C19H20Cl3NO3 and a molecular weight of 416.73 g/mol. Its IUPAC name is [(2R)-3,4,4-trichlorobut-3-en-2-yl] (1S,6S)-6-(benzylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2R)-3,4,4-trichlorobut-3-en-2-yl] (1S,6S)-6-(benzylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 1381151 |
| Molecular Formula | C19H20Cl3NO3 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [(2R)-3,4,4-trichlorobut-3-en-2-yl] (1S,6S)-6-(benzylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@H]1CC=CC[C@@H]1C(=O)NCc1ccccc1)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C19H20Cl3NO3/c1-12(16(20)17(21)22)26-19(25)15-10-6-5-9-14(15)18(24)23-11-13-7-3-2-4-8-13/h2-8,12,14-15H,9-11H2,1H3,(H,23,24)/t12-,14+,15+/m1/s1 |
| InChIKey | JVSIPXAAPBRSQS-SNPRPXQTSA-N |
| XLogP | 4.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|