C40H73N2O6P — CID 138116094
[(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]heptadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138116094) has the molecular formula C40H73N2O6P and a molecular weight of 709.01 g/mol. Its IUPAC name is [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]heptadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]heptadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138116094 |
| Molecular Formula | C40H73N2O6P |
| Molecular Weight | 709.01 g/mol |
| Exact Mass | 708.52 |
| IUPAC Name | [(4E,8E,12E)-3-hydroxy-2-[[(10Z,12Z)-octadeca-10,12-dienoyl]amino]heptadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C40H73N2O6P/c1-6-8-10-12-14-16-18-20-21-22-24-26-28-30-32-34-40(44)41-38(37-48-49(45,46)47-36-35-42(3,4)5)39(43)33-31-29-27-25-23-19-17-15-13-11-9-7-2/h13-16,18,20,23,25,31,33,38-39,43H,6-12,17,19,21-22,24,26-30,32,34-37H2,1-5H3,(H-,41,44,45,46)/b15-13+,16-14-,20-18-,25-23+,33-31+ |
| InChIKey | AAWIDXMKXKJYHO-ZEACKKSZSA-N |
| XLogP | 9.27 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.01 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|